About (4R)-3-propyl-1,3-thiazolidine-4-carboxylic acid
(4R)-3-propyl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 90896026) has the molecular formula C7H13NO2S
and a molecular weight of 175.25 g/mol. Its IUPAC name is (4R)-3-propyl-1,3-thiazolidine-4-carboxylic acid.
Molecular Properties
| Compound Name | (4R)-3-propyl-1,3-thiazolidine-4-carboxylic acid |
| PubChem CID | 90896026 |
| Molecular Formula | C7H13NO2S |
| Molecular Weight | 175.25 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | (4R)-3-propyl-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CCCN1CSC[C@H]1C(=O)O |
| InChI | InChI=1S/C7H13NO2S/c1-2-3-8-5-11-4-6(8)7(9)10/h6H,2-5H2,1H3,(H,9,10)/t6-/m0/s1 |
| InChIKey | OGDODKXJGAJYRC-LURJTMIESA-N |
| XLogP | 0.86 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.25 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R)-3-propyl-1,3-thiazolidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-3-propyl-1,3-thiazolidine-4-carboxylic acid?
The IUPAC name of (4R)-3-propyl-1,3-thiazolidine-4-carboxylic acid (CID 90896026) is (4R)-3-propyl-1,3-thiazolidine-4-carboxylic acid.
What is the SMILES notation for (4R)-3-propyl-1,3-thiazolidine-4-carboxylic acid?
The canonical SMILES for (4R)-3-propyl-1,3-thiazolidine-4-carboxylic acid is CCCN1CSC[C@H]1C(=O)O.
What is the InChIKey of (4R)-3-propyl-1,3-thiazolidine-4-carboxylic acid?
The InChIKey is OGDODKXJGAJYRC-LURJTMIESA-N. The full InChI is InChI=1S/C7H13NO2S/c1-2-3-8-5-11-4-6(8)7(9)10/h6H,2-5H2,1H3,(H,9,10)/t6-/m0/s1.
What are the key properties of (4R)-3-propyl-1,3-thiazolidine-4-carboxylic acid?
(4R)-3-propyl-1,3-thiazolidine-4-carboxylic acid has a molecular weight of 175.25 g/mol, XLogP of 0.86, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-3-propyl-1,3-thiazolidine-4-carboxylic acid is sourced from PubChem (CID 90896026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).