C20H16ClFN4O5 — CID 90896220
5-(6-chloro-6,7-dihydrofuro[3,2-c]pyridin-2-yl)-5-[(4-fluoro-5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione (PubChem CID 90896220) has the molecular formula C20H16ClFN4O5 and a molecular weight of 446.82 g/mol. Its IUPAC name is 5-(6-chloro-6,7-dihydrofuro[3,2-c]pyridin-2-yl)-5-[(4-fluoro-5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | 5-(6-chloro-6,7-dihydrofuro[3,2-c]pyridin-2-yl)-5-[(4-fluoro-5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 90896220 |
| Molecular Formula | C20H16ClFN4O5 |
| Molecular Weight | 446.82 g/mol |
| Exact Mass | 446.08 |
| IUPAC Name | 5-(6-chloro-6,7-dihydrofuro[3,2-c]pyridin-2-yl)-5-[(4-fluoro-5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc2c(c1F)C(=O)N(CC1(c3cc4c(o3)CC(Cl)N=C4)NC(=O)NC1=O)C2 |
| InChI | InChI=1S/C20H16ClFN4O5/c1-30-11-3-2-9-7-26(17(27)15(9)16(11)22)8-20(18(28)24-19(29)25-20)13-4-10-6-23-14(21)5-12(10)31-13/h2-4,6,14H,5,7-8H2,1H3,(H2,24,25,28,29) |
| InChIKey | LZNXSZFUBQGWJF-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 113.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.82 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|