About 4-bromo-6-propan-2-yl-1,3-benzothiazole
4-bromo-6-propan-2-yl-1,3-benzothiazole (PubChem CID 90896467) has the molecular formula C10H10BrNS
and a molecular weight of 256.17 g/mol. Its IUPAC name is 4-bromo-6-propan-2-yl-1,3-benzothiazole.
Molecular Properties
| Compound Name | 4-bromo-6-propan-2-yl-1,3-benzothiazole |
| PubChem CID | 90896467 |
| Molecular Formula | C10H10BrNS |
| Molecular Weight | 256.17 g/mol |
| Exact Mass | 254.97 |
| IUPAC Name | 4-bromo-6-propan-2-yl-1,3-benzothiazole |
| SMILES | CC(C)c1cc(Br)c2ncsc2c1 |
| InChI | InChI=1S/C10H10BrNS/c1-6(2)7-3-8(11)10-9(4-7)13-5-12-10/h3-6H,1-2H3 |
| InChIKey | VLCFMYUIEWIESD-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.17 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-bromo-6-propan-2-yl-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-6-propan-2-yl-1,3-benzothiazole?
The IUPAC name of 4-bromo-6-propan-2-yl-1,3-benzothiazole (CID 90896467) is 4-bromo-6-propan-2-yl-1,3-benzothiazole.
What is the SMILES notation for 4-bromo-6-propan-2-yl-1,3-benzothiazole?
The canonical SMILES for 4-bromo-6-propan-2-yl-1,3-benzothiazole is CC(C)c1cc(Br)c2ncsc2c1.
What is the InChIKey of 4-bromo-6-propan-2-yl-1,3-benzothiazole?
The InChIKey is VLCFMYUIEWIESD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BrNS/c1-6(2)7-3-8(11)10-9(4-7)13-5-12-10/h3-6H,1-2H3.
What are the key properties of 4-bromo-6-propan-2-yl-1,3-benzothiazole?
4-bromo-6-propan-2-yl-1,3-benzothiazole has a molecular weight of 256.17 g/mol, XLogP of 4.18, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-6-propan-2-yl-1,3-benzothiazole is sourced from PubChem (CID 90896467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).