C13H18N2 — CID 90896484
1,2,4a,5,5a,6,10a,10b-octahydrocyclohepta[b]indol-6-amine (PubChem CID 90896484) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 1,2,4a,5,5a,6,10a,10b-octahydrocyclohepta[b]indol-6-amine.
| Compound Name | 1,2,4a,5,5a,6,10a,10b-octahydrocyclohepta[b]indol-6-amine |
|---|---|
| PubChem CID | 90896484 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 1,2,4a,5,5a,6,10a,10b-octahydrocyclohepta[b]indol-6-amine |
| SMILES | NC1C=CC=CC2C3CCC=CC3NC12 |
| InChI | InChI=1S/C13H18N2/c14-11-7-3-1-6-10-9-5-2-4-8-12(9)15-13(10)11/h1,3-4,6-13,15H,2,5,14H2 |
| InChIKey | QQNLSFYRVTYTSP-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|