C36H44N6O6 — CID 90896752
7-methoxy-6-(2-methoxyethoxy)-N-[1-[3-[(2-methylpropan-2-yl)oxy]oxiran-2-yl]indazol-5-yl]-2-[3-[(3-propyloxiran-2-yl)amino]phenyl]-1,2-dihydroquinazolin-4-amine (PubChem CID 90896752) has the molecular formula C36H44N6O6 and a molecular weight of 656.78 g/mol. Its IUPAC name is 7-methoxy-6-(2-methoxyethoxy)-N-[1-[3-[(2-methylpropan-2-yl)oxy]oxiran-2-yl]indazol-5-yl]-2-[3-[(3-propyloxiran-2-yl)amino]phenyl]-1,2-dihydroquinazolin-4-amine.
| Compound Name | 7-methoxy-6-(2-methoxyethoxy)-N-[1-[3-[(2-methylpropan-2-yl)oxy]oxiran-2-yl]indazol-5-yl]-2-[3-[(3-propyloxiran-2-yl)amino]phenyl]-1,2-dihydroquinazolin-4-amine |
|---|---|
| PubChem CID | 90896752 |
| Molecular Formula | C36H44N6O6 |
| Molecular Weight | 656.78 g/mol |
| Exact Mass | 656.33 |
| IUPAC Name | 7-methoxy-6-(2-methoxyethoxy)-N-[1-[3-[(2-methylpropan-2-yl)oxy]oxiran-2-yl]indazol-5-yl]-2-[3-[(3-propyloxiran-2-yl)amino]phenyl]-1,2-dihydroquinazolin-4-amine |
| SMILES | CCCC1OC1Nc1cccc(C2N=C(Nc3ccc4c(cnn4C4OC4OC(C)(C)C)c3)c3cc(OCCOC)c(OC)cc3N2)c1 |
| InChI | InChI=1S/C36H44N6O6/c1-7-9-28-33(46-28)39-23-11-8-10-21(16-23)31-40-26-19-29(44-6)30(45-15-14-43-5)18-25(26)32(41-31)38-24-12-13-27-22(17-24)20-37-42(27)34-35(47-34)48-36(2,3)4/h8,10-13,16-20,28,31,33-35,39-40H,7,9,14-15H2,1-6H3,(H,38,41) |
| InChIKey | IEYCAGRIYIWFRS-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 128.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.78 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|