C20H18FN3O6 — CID 9089677
(E)-N-[2-(4-fluoroanilino)-2-oxoethyl]-N-methyl-3-(6-nitro-4H-1,3-benzodioxin-8-yl)prop-2-enamide (PubChem CID 9089677) has the molecular formula C20H18FN3O6 and a molecular weight of 415.38 g/mol. Its IUPAC name is (E)-N-[2-(4-fluoroanilino)-2-oxoethyl]-N-methyl-3-(6-nitro-4H-1,3-benzodioxin-8-yl)prop-2-enamide.
| Compound Name | (E)-N-[2-(4-fluoroanilino)-2-oxoethyl]-N-methyl-3-(6-nitro-4H-1,3-benzodioxin-8-yl)prop-2-enamide |
|---|---|
| PubChem CID | 9089677 |
| Molecular Formula | C20H18FN3O6 |
| Molecular Weight | 415.38 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | (E)-N-[2-(4-fluoroanilino)-2-oxoethyl]-N-methyl-3-(6-nitro-4H-1,3-benzodioxin-8-yl)prop-2-enamide |
| SMILES | CN(CC(=O)Nc1ccc(F)cc1)C(=O)/C=C/c1cc([N+](=O)[O-])cc2c1OCOC2 |
| InChI | InChI=1S/C20H18FN3O6/c1-23(10-18(25)22-16-5-3-15(21)4-6-16)19(26)7-2-13-8-17(24(27)28)9-14-11-29-12-30-20(13)14/h2-9H,10-12H2,1H3,(H,22,25)/b7-2+ |
| InChIKey | WXPBPNVEUPIBPO-FARCUNLSSA-N |
| XLogP | 2.71 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.38 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|