C24H17F3N2O3 — CID 90897494
methyl 2-oxo-3-[C-phenyl-N-[4-(trifluoromethyl)phenyl]carbonimidoyl]-1,3-dihydroindole-6-carboxylate (PubChem CID 90897494) has the molecular formula C24H17F3N2O3 and a molecular weight of 438.41 g/mol. Its IUPAC name is methyl 2-oxo-3-[C-phenyl-N-[4-(trifluoromethyl)phenyl]carbonimidoyl]-1,3-dihydroindole-6-carboxylate.
| Compound Name | methyl 2-oxo-3-[C-phenyl-N-[4-(trifluoromethyl)phenyl]carbonimidoyl]-1,3-dihydroindole-6-carboxylate |
|---|---|
| PubChem CID | 90897494 |
| Molecular Formula | C24H17F3N2O3 |
| Molecular Weight | 438.41 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | methyl 2-oxo-3-[C-phenyl-N-[4-(trifluoromethyl)phenyl]carbonimidoyl]-1,3-dihydroindole-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)NC(=O)C2/C(=N/c1ccc(C(F)(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H17F3N2O3/c1-32-23(31)15-7-12-18-19(13-15)29-22(30)20(18)21(14-5-3-2-4-6-14)28-17-10-8-16(9-11-17)24(25,26)27/h2-13,20H,1H3,(H,29,30)/b28-21+ |
| InChIKey | OXUJVEZCGSFQTD-SGWCAAJKSA-N |
| XLogP | 5.35 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.41 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|