About (5-amino-2,4-dimethylphenyl)-[3-(2-pyridin-2-ylethenyl)-1H-indazol-6-yl]methanone
(5-amino-2,4-dimethylphenyl)-[3-(2-pyridin-2-ylethenyl)-1H-indazol-6-yl]methanone (PubChem CID 90897556) has the molecular formula C23H20N4O
and a molecular weight of 368.44 g/mol. Its IUPAC name is (5-amino-2,4-dimethylphenyl)-[3-(2-pyridin-2-ylethenyl)-1H-indazol-6-yl]methanone.
Molecular Properties
| Compound Name | (5-amino-2,4-dimethylphenyl)-[3-(2-pyridin-2-ylethenyl)-1H-indazol-6-yl]methanone |
| PubChem CID | 90897556 |
| Molecular Formula | C23H20N4O |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | (5-amino-2,4-dimethylphenyl)-[3-(2-pyridin-2-ylethenyl)-1H-indazol-6-yl]methanone |
| SMILES | Cc1cc(C)c(C(=O)c2ccc3c(C=Cc4ccccn4)n[nH]c3c2)cc1N |
| InChI | InChI=1S/C23H20N4O/c1-14-11-15(2)20(24)13-19(14)23(28)16-6-8-18-21(26-27-22(18)12-16)9-7-17-5-3-4-10-25-17/h3-13H,24H2,1-2H3,(H,26,27) |
| InChIKey | IJSAVCNZZPTSQI-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (5-amino-2,4-dimethylphenyl)-[3-(2-pyridin-2-ylethenyl)-1H-indazol-6-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-amino-2,4-dimethylphenyl)-[3-(2-pyridin-2-ylethenyl)-1H-indazol-6-yl]methanone?
The IUPAC name of (5-amino-2,4-dimethylphenyl)-[3-(2-pyridin-2-ylethenyl)-1H-indazol-6-yl]methanone (CID 90897556) is (5-amino-2,4-dimethylphenyl)-[3-(2-pyridin-2-ylethenyl)-1H-indazol-6-yl]methanone.
What is the SMILES notation for (5-amino-2,4-dimethylphenyl)-[3-(2-pyridin-2-ylethenyl)-1H-indazol-6-yl]methanone?
The canonical SMILES for (5-amino-2,4-dimethylphenyl)-[3-(2-pyridin-2-ylethenyl)-1H-indazol-6-yl]methanone is Cc1cc(C)c(C(=O)c2ccc3c(C=Cc4ccccn4)n[nH]c3c2)cc1N.
What is the InChIKey of (5-amino-2,4-dimethylphenyl)-[3-(2-pyridin-2-ylethenyl)-1H-indazol-6-yl]methanone?
The InChIKey is IJSAVCNZZPTSQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20N4O/c1-14-11-15(2)20(24)13-19(14)23(28)16-6-8-18-21(26-27-22(18)12-16)9-7-17-5-3-4-10-25-17/h3-13H,24H2,1-2H3,(H,26,27).
What are the key properties of (5-amino-2,4-dimethylphenyl)-[3-(2-pyridin-2-ylethenyl)-1H-indazol-6-yl]methanone?
(5-amino-2,4-dimethylphenyl)-[3-(2-pyridin-2-ylethenyl)-1H-indazol-6-yl]methanone has a molecular weight of 368.44 g/mol, XLogP of 4.56, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-amino-2,4-dimethylphenyl)-[3-(2-pyridin-2-ylethenyl)-1H-indazol-6-yl]methanone is sourced from PubChem (CID 90897556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).