About ethyl 3-(2,4-difluorophenyl)imino-2-(4-methoxyphenyl)propanoate
ethyl 3-(2,4-difluorophenyl)imino-2-(4-methoxyphenyl)propanoate (PubChem CID 90898836) has the molecular formula C18H17F2NO3
and a molecular weight of 333.33 g/mol. Its IUPAC name is ethyl 3-(2,4-difluorophenyl)imino-2-(4-methoxyphenyl)propanoate.
Molecular Properties
| Compound Name | ethyl 3-(2,4-difluorophenyl)imino-2-(4-methoxyphenyl)propanoate |
| PubChem CID | 90898836 |
| Molecular Formula | C18H17F2NO3 |
| Molecular Weight | 333.33 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | ethyl 3-(2,4-difluorophenyl)imino-2-(4-methoxyphenyl)propanoate |
| SMILES | CCOC(=O)C(/C=N/c1ccc(F)cc1F)c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H17F2NO3/c1-3-24-18(22)15(12-4-7-14(23-2)8-5-12)11-21-17-9-6-13(19)10-16(17)20/h4-11,15H,3H2,1-2H3/b21-11+ |
| InChIKey | LPOBTYWHQDMCDE-SRZZPIQSSA-N |
| XLogP | 4.02 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.33 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-(2,4-difluorophenyl)imino-2-(4-methoxyphenyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(2,4-difluorophenyl)imino-2-(4-methoxyphenyl)propanoate?
The IUPAC name of ethyl 3-(2,4-difluorophenyl)imino-2-(4-methoxyphenyl)propanoate (CID 90898836) is ethyl 3-(2,4-difluorophenyl)imino-2-(4-methoxyphenyl)propanoate.
What is the SMILES notation for ethyl 3-(2,4-difluorophenyl)imino-2-(4-methoxyphenyl)propanoate?
The canonical SMILES for ethyl 3-(2,4-difluorophenyl)imino-2-(4-methoxyphenyl)propanoate is CCOC(=O)C(/C=N/c1ccc(F)cc1F)c1ccc(OC)cc1.
What is the InChIKey of ethyl 3-(2,4-difluorophenyl)imino-2-(4-methoxyphenyl)propanoate?
The InChIKey is LPOBTYWHQDMCDE-SRZZPIQSSA-N. The full InChI is InChI=1S/C18H17F2NO3/c1-3-24-18(22)15(12-4-7-14(23-2)8-5-12)11-21-17-9-6-13(19)10-16(17)20/h4-11,15H,3H2,1-2H3/b21-11+.
What are the key properties of ethyl 3-(2,4-difluorophenyl)imino-2-(4-methoxyphenyl)propanoate?
ethyl 3-(2,4-difluorophenyl)imino-2-(4-methoxyphenyl)propanoate has a molecular weight of 333.33 g/mol, XLogP of 4.02, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(2,4-difluorophenyl)imino-2-(4-methoxyphenyl)propanoate is sourced from PubChem (CID 90898836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).