C40H46N4O6 — CID 90898889
methyl 7-(2-methylbutanoyl)-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxylate;methyl 7-prop-2-enoyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxylate (PubChem CID 90898889) has the molecular formula C40H46N4O6 and a molecular weight of 678.83 g/mol. Its IUPAC name is methyl 7-(2-methylbutanoyl)-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxylate;methyl 7-prop-2-enoyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxylate.
| Compound Name | methyl 7-(2-methylbutanoyl)-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxylate;methyl 7-prop-2-enoyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxylate |
|---|---|
| PubChem CID | 90898889 |
| Molecular Formula | C40H46N4O6 |
| Molecular Weight | 678.83 g/mol |
| Exact Mass | 678.34 |
| IUPAC Name | methyl 7-(2-methylbutanoyl)-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxylate;methyl 7-prop-2-enoyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxylate |
| SMILES | C=CC(=O)N1CC(C(=O)OC)CC2c3cccc4[nH]cc(c34)CC21.CCC(C)C(=O)N1CC(C(=O)OC)CC2c3cccc4[nH]cc(c34)CC21 |
| InChI | InChI=1S/C21H26N2O3.C19H20N2O3/c1-4-12(2)20(24)23-11-14(21(25)26-3)8-16-15-6-5-7-17-19(15)13(10-22-17)9-18(16)23;1-3-17(22)21-10-12(19(23)24-2)7-14-13-5-4-6-15-18(13)11(9-20-15)8-16(14)21/h5-7,10,12,14,16,18,22H,4,8-9,11H2,1-3H3;3-6,9,12,14,16,20H,1,7-8,10H2,2H3 |
| InChIKey | JCQNBNBHPAOJSJ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 124.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.83 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|