C22H18F3N3O4S — CID 90899969
N-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-5-yl]methyl]-4-(trifluoromethylsulfanyl)benzamide (PubChem CID 90899969) has the molecular formula C22H18F3N3O4S and a molecular weight of 477.46 g/mol. Its IUPAC name is N-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-5-yl]methyl]-4-(trifluoromethylsulfanyl)benzamide.
| Compound Name | N-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-5-yl]methyl]-4-(trifluoromethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 90899969 |
| Molecular Formula | C22H18F3N3O4S |
| Molecular Weight | 477.46 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | N-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-5-yl]methyl]-4-(trifluoromethylsulfanyl)benzamide |
| SMILES | O=C1CCC(n2cc3cc(CNC(=O)c4ccc(SC(F)(F)F)cc4)ccc3c2O)C(=O)N1 |
| InChI | InChI=1S/C22H18F3N3O4S/c23-22(24,25)33-15-4-2-13(3-5-15)19(30)26-10-12-1-6-16-14(9-12)11-28(21(16)32)17-7-8-18(29)27-20(17)31/h1-6,9,11,17,32H,7-8,10H2,(H,26,30)(H,27,29,31) |
| InChIKey | OCKJWMVMQWYRLX-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.46 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|