C30H35Cl4N5O4 — CID 90900312
3,5-dichloro-N-[(2E)-3-(3,4-dichlorophenyl)-2-methoxyimino-5-[4-[(3S)-3-methyl-2,5-dioxopiperazin-1-yl]piperidin-1-yl]pentyl]-N-methylbenzamide (PubChem CID 90900312) has the molecular formula C30H35Cl4N5O4 and a molecular weight of 671.45 g/mol. Its IUPAC name is 3,5-dichloro-N-[(2E)-3-(3,4-dichlorophenyl)-2-methoxyimino-5-[4-[(3S)-3-methyl-2,5-dioxopiperazin-1-yl]piperidin-1-yl]pentyl]-N-methylbenzamide.
| Compound Name | 3,5-dichloro-N-[(2E)-3-(3,4-dichlorophenyl)-2-methoxyimino-5-[4-[(3S)-3-methyl-2,5-dioxopiperazin-1-yl]piperidin-1-yl]pentyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 90900312 |
| Molecular Formula | C30H35Cl4N5O4 |
| Molecular Weight | 671.45 g/mol |
| Exact Mass | 669.14 |
| IUPAC Name | 3,5-dichloro-N-[(2E)-3-(3,4-dichlorophenyl)-2-methoxyimino-5-[4-[(3S)-3-methyl-2,5-dioxopiperazin-1-yl]piperidin-1-yl]pentyl]-N-methylbenzamide |
| SMILES | CO/N=C(/CN(C)C(=O)c1cc(Cl)cc(Cl)c1)C(CCN1CCC(N2CC(=O)N[C@@H](C)C2=O)CC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C30H35Cl4N5O4/c1-18-29(41)39(17-28(40)35-18)23-6-9-38(10-7-23)11-8-24(19-4-5-25(33)26(34)14-19)27(36-43-3)16-37(2)30(42)20-12-21(31)15-22(32)13-20/h4-5,12-15,18,23-24H,6-11,16-17H2,1-3H3,(H,35,40)/b36-27-/t18-,24?/m0/s1 |
| InChIKey | SCASLNUBDFNRBG-KLXRAMEPSA-N |
| XLogP | 5.36 |
| TPSA | 94.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.45 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|