C30H30ClFN6O2 — CID 90900388
3-[3-chloro-5-[4-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-3-propan-2-ylanilino]phenyl]phenol (PubChem CID 90900388) has the molecular formula C30H30ClFN6O2 and a molecular weight of 561.06 g/mol. Its IUPAC name is 3-[3-chloro-5-[4-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-3-propan-2-ylanilino]phenyl]phenol.
| Compound Name | 3-[3-chloro-5-[4-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-3-propan-2-ylanilino]phenyl]phenol |
|---|---|
| PubChem CID | 90900388 |
| Molecular Formula | C30H30ClFN6O2 |
| Molecular Weight | 561.06 g/mol |
| Exact Mass | 560.21 |
| IUPAC Name | 3-[3-chloro-5-[4-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-3-propan-2-ylanilino]phenyl]phenol |
| SMILES | CC(C)c1cc(Nc2cc(Cl)cc(-c3cccc(O)c3)c2)ccc1C/N=N/c1ncc(F)c(N2CCOCC2)n1 |
| InChI | InChI=1S/C30H30ClFN6O2/c1-19(2)27-16-24(35-25-13-22(12-23(31)15-25)20-4-3-5-26(39)14-20)7-6-21(27)17-34-37-30-33-18-28(32)29(36-30)38-8-10-40-11-9-38/h3-7,12-16,18-19,35,39H,8-11,17H2,1-2H3/b37-34+ |
| InChIKey | PYJOGOWREWTPRF-NFSLGCCLSA-N |
| XLogP | 7.63 |
| TPSA | 95.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.06 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|