C17H29FO2S2 — CID 90900450
5,9,13-trimethyl-2-sulfanyltetradeca-4,8,12-triene-1-sulfonyl fluoride (PubChem CID 90900450) has the molecular formula C17H29FO2S2 and a molecular weight of 348.55 g/mol. Its IUPAC name is 5,9,13-trimethyl-2-sulfanyltetradeca-4,8,12-triene-1-sulfonyl fluoride.
| Compound Name | 5,9,13-trimethyl-2-sulfanyltetradeca-4,8,12-triene-1-sulfonyl fluoride |
|---|---|
| PubChem CID | 90900450 |
| Molecular Formula | C17H29FO2S2 |
| Molecular Weight | 348.55 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 5,9,13-trimethyl-2-sulfanyltetradeca-4,8,12-triene-1-sulfonyl fluoride |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCC(S)CS(=O)(=O)F |
| InChI | InChI=1S/C17H29FO2S2/c1-14(2)7-5-8-15(3)9-6-10-16(4)11-12-17(21)13-22(18,19)20/h7,9,11,17,21H,5-6,8,10,12-13H2,1-4H3 |
| InChIKey | DDPFVVYJETYOQJ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 34.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.55 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|