About 1-tert-butyl-8-[4-(trifluoromethyl)phenyl]-6,8a-dihydro-5H-1,7-naphthyridine
1-tert-butyl-8-[4-(trifluoromethyl)phenyl]-6,8a-dihydro-5H-1,7-naphthyridine (PubChem CID 90900563) has the molecular formula C19H21F3N2
and a molecular weight of 334.39 g/mol. Its IUPAC name is 1-tert-butyl-8-[4-(trifluoromethyl)phenyl]-6,8a-dihydro-5H-1,7-naphthyridine.
Molecular Properties
| Compound Name | 1-tert-butyl-8-[4-(trifluoromethyl)phenyl]-6,8a-dihydro-5H-1,7-naphthyridine |
| PubChem CID | 90900563 |
| Molecular Formula | C19H21F3N2 |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | 1-tert-butyl-8-[4-(trifluoromethyl)phenyl]-6,8a-dihydro-5H-1,7-naphthyridine |
| SMILES | CC(C)(C)N1C=CC=C2CCN=C(c3ccc(C(F)(F)F)cc3)C21 |
| InChI | InChI=1S/C19H21F3N2/c1-18(2,3)24-12-4-5-14-10-11-23-16(17(14)24)13-6-8-15(9-7-13)19(20,21)22/h4-9,12,17H,10-11H2,1-3H3 |
| InChIKey | OCZKLQQATWQBGL-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-tert-butyl-8-[4-(trifluoromethyl)phenyl]-6,8a-dihydro-5H-1,7-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-8-[4-(trifluoromethyl)phenyl]-6,8a-dihydro-5H-1,7-naphthyridine?
The IUPAC name of 1-tert-butyl-8-[4-(trifluoromethyl)phenyl]-6,8a-dihydro-5H-1,7-naphthyridine (CID 90900563) is 1-tert-butyl-8-[4-(trifluoromethyl)phenyl]-6,8a-dihydro-5H-1,7-naphthyridine.
What is the SMILES notation for 1-tert-butyl-8-[4-(trifluoromethyl)phenyl]-6,8a-dihydro-5H-1,7-naphthyridine?
The canonical SMILES for 1-tert-butyl-8-[4-(trifluoromethyl)phenyl]-6,8a-dihydro-5H-1,7-naphthyridine is CC(C)(C)N1C=CC=C2CCN=C(c3ccc(C(F)(F)F)cc3)C21.
What is the InChIKey of 1-tert-butyl-8-[4-(trifluoromethyl)phenyl]-6,8a-dihydro-5H-1,7-naphthyridine?
The InChIKey is OCZKLQQATWQBGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21F3N2/c1-18(2,3)24-12-4-5-14-10-11-23-16(17(14)24)13-6-8-15(9-7-13)19(20,21)22/h4-9,12,17H,10-11H2,1-3H3.
What are the key properties of 1-tert-butyl-8-[4-(trifluoromethyl)phenyl]-6,8a-dihydro-5H-1,7-naphthyridine?
1-tert-butyl-8-[4-(trifluoromethyl)phenyl]-6,8a-dihydro-5H-1,7-naphthyridine has a molecular weight of 334.39 g/mol, XLogP of 4.82, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-8-[4-(trifluoromethyl)phenyl]-6,8a-dihydro-5H-1,7-naphthyridine is sourced from PubChem (CID 90900563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).