About (3R)-3-ethyl-1-methyl-3H-2,1-benzoxaborole;methoxymethanol
(3R)-3-ethyl-1-methyl-3H-2,1-benzoxaborole;methoxymethanol (PubChem CID 90900665) has the molecular formula C12H19BO3
and a molecular weight of 222.09 g/mol. Its IUPAC name is (3R)-3-ethyl-1-methyl-3H-2,1-benzoxaborole;methoxymethanol.
Molecular Properties
| Compound Name | (3R)-3-ethyl-1-methyl-3H-2,1-benzoxaborole;methoxymethanol |
| PubChem CID | 90900665 |
| Molecular Formula | C12H19BO3 |
| Molecular Weight | 222.09 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | (3R)-3-ethyl-1-methyl-3H-2,1-benzoxaborole;methoxymethanol |
| SMILES | CC[C@H]1OB(C)c2ccccc21.COCO |
| InChI | InChI=1S/C10H13BO.C2H6O2/c1-3-10-8-6-4-5-7-9(8)11(2)12-10;1-4-2-3/h4-7,10H,3H2,1-2H3;3H,2H2,1H3/t10-;/m1./s1 |
| InChIKey | MGSFZQNTHSYBQW-HNCPQSOCSA-N |
| XLogP | 1.58 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.09 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-ethyl-1-methyl-3H-2,1-benzoxaborole;methoxymethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-ethyl-1-methyl-3H-2,1-benzoxaborole;methoxymethanol?
The IUPAC name of (3R)-3-ethyl-1-methyl-3H-2,1-benzoxaborole;methoxymethanol (CID 90900665) is (3R)-3-ethyl-1-methyl-3H-2,1-benzoxaborole;methoxymethanol.
What is the SMILES notation for (3R)-3-ethyl-1-methyl-3H-2,1-benzoxaborole;methoxymethanol?
The canonical SMILES for (3R)-3-ethyl-1-methyl-3H-2,1-benzoxaborole;methoxymethanol is CC[C@H]1OB(C)c2ccccc21.COCO.
What is the InChIKey of (3R)-3-ethyl-1-methyl-3H-2,1-benzoxaborole;methoxymethanol?
The InChIKey is MGSFZQNTHSYBQW-HNCPQSOCSA-N. The full InChI is InChI=1S/C10H13BO.C2H6O2/c1-3-10-8-6-4-5-7-9(8)11(2)12-10;1-4-2-3/h4-7,10H,3H2,1-2H3;3H,2H2,1H3/t10-;/m1./s1.
What are the key properties of (3R)-3-ethyl-1-methyl-3H-2,1-benzoxaborole;methoxymethanol?
(3R)-3-ethyl-1-methyl-3H-2,1-benzoxaborole;methoxymethanol has a molecular weight of 222.09 g/mol, XLogP of 1.58, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-ethyl-1-methyl-3H-2,1-benzoxaborole;methoxymethanol is sourced from PubChem (CID 90900665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).