C30H24N2O3S+2 — CID 90900680
5-methoxy-3-oxa-1-azoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4,6,8(16),9,11(15),12-heptaene;5-methylsulfanyl-3-oxa-1-azoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4,6,8(16),9,11(15),12-heptaene (PubChem CID 90900680) has the molecular formula C30H24N2O3S+2 and a molecular weight of 492.60 g/mol. Its IUPAC name is 5-methoxy-3-oxa-1-azoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4,6,8(16),9,11(15),12-heptaene;5-methylsulfanyl-3-oxa-1-azoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4,6,8(16),9,11(15),12-heptaene.
| Compound Name | 5-methoxy-3-oxa-1-azoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4,6,8(16),9,11(15),12-heptaene;5-methylsulfanyl-3-oxa-1-azoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4,6,8(16),9,11(15),12-heptaene |
|---|---|
| PubChem CID | 90900680 |
| Molecular Formula | C30H24N2O3S+2 |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | 5-methoxy-3-oxa-1-azoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4,6,8(16),9,11(15),12-heptaene;5-methylsulfanyl-3-oxa-1-azoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4,6,8(16),9,11(15),12-heptaene |
| SMILES | COc1ccc2ccc3ccc[n+]4c3c2c1OC4.CSc1ccc2ccc3ccc[n+]4c3c2c1OC4 |
| InChI | InChI=1S/C15H12NO2.C15H12NOS/c1-17-12-7-6-10-4-5-11-3-2-8-16-9-18-15(12)13(10)14(11)16;1-18-12-7-6-10-4-5-11-3-2-8-16-9-17-15(12)13(10)14(11)16/h2*2-8H,9H2,1H3/q2*+1 |
| InChIKey | WTJDKJMEFQVVGY-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 35.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|