About 1-[3,3,5-tris(2-sulfanylpropylsulfanyl)pentylsulfanyl]propane-2-thiol
1-[3,3,5-tris(2-sulfanylpropylsulfanyl)pentylsulfanyl]propane-2-thiol (PubChem CID 90900971) has the molecular formula C17H36S8
and a molecular weight of 497.01 g/mol. Its IUPAC name is 1-[3,3,5-tris(2-sulfanylpropylsulfanyl)pentylsulfanyl]propane-2-thiol.
Molecular Properties
| Compound Name | 1-[3,3,5-tris(2-sulfanylpropylsulfanyl)pentylsulfanyl]propane-2-thiol |
| PubChem CID | 90900971 |
| Molecular Formula | C17H36S8 |
| Molecular Weight | 497.01 g/mol |
| Exact Mass | 496.06 |
| IUPAC Name | 1-[3,3,5-tris(2-sulfanylpropylsulfanyl)pentylsulfanyl]propane-2-thiol |
| SMILES | CC(S)CSCCC(CCSCC(C)S)(SCC(C)S)SCC(C)S |
| InChI | InChI=1S/C17H36S8/c1-13(18)9-22-7-5-17(24-11-15(3)20,25-12-16(4)21)6-8-23-10-14(2)19/h13-16,18-21H,5-12H2,1-4H3 |
| InChIKey | ZELAUSPCESKJRC-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 497.01 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[3,3,5-tris(2-sulfanylpropylsulfanyl)pentylsulfanyl]propane-2-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3,3,5-tris(2-sulfanylpropylsulfanyl)pentylsulfanyl]propane-2-thiol?
The IUPAC name of 1-[3,3,5-tris(2-sulfanylpropylsulfanyl)pentylsulfanyl]propane-2-thiol (CID 90900971) is 1-[3,3,5-tris(2-sulfanylpropylsulfanyl)pentylsulfanyl]propane-2-thiol.
What is the SMILES notation for 1-[3,3,5-tris(2-sulfanylpropylsulfanyl)pentylsulfanyl]propane-2-thiol?
The canonical SMILES for 1-[3,3,5-tris(2-sulfanylpropylsulfanyl)pentylsulfanyl]propane-2-thiol is CC(S)CSCCC(CCSCC(C)S)(SCC(C)S)SCC(C)S.
What is the InChIKey of 1-[3,3,5-tris(2-sulfanylpropylsulfanyl)pentylsulfanyl]propane-2-thiol?
The InChIKey is ZELAUSPCESKJRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H36S8/c1-13(18)9-22-7-5-17(24-11-15(3)20,25-12-16(4)21)6-8-23-10-14(2)19/h13-16,18-21H,5-12H2,1-4H3.
What are the key properties of 1-[3,3,5-tris(2-sulfanylpropylsulfanyl)pentylsulfanyl]propane-2-thiol?
1-[3,3,5-tris(2-sulfanylpropylsulfanyl)pentylsulfanyl]propane-2-thiol has a molecular weight of 497.01 g/mol, XLogP of 6.67, 16 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3,3,5-tris(2-sulfanylpropylsulfanyl)pentylsulfanyl]propane-2-thiol is sourced from PubChem (CID 90900971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).