About (3S)-3-butyl-3-ethyl-1,1-dioxo-5-phenyl-2,5-dihydro-1λ6-benzothiepin-4-one
(3S)-3-butyl-3-ethyl-1,1-dioxo-5-phenyl-2,5-dihydro-1λ6-benzothiepin-4-one (PubChem CID 90901028) has the molecular formula C22H26O3S
and a molecular weight of 370.51 g/mol. Its IUPAC name is (3S)-3-butyl-3-ethyl-1,1-dioxo-5-phenyl-2,5-dihydro-1λ6-benzothiepin-4-one.
Molecular Properties
| Compound Name | (3S)-3-butyl-3-ethyl-1,1-dioxo-5-phenyl-2,5-dihydro-1λ6-benzothiepin-4-one |
| PubChem CID | 90901028 |
| Molecular Formula | C22H26O3S |
| Molecular Weight | 370.51 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | (3S)-3-butyl-3-ethyl-1,1-dioxo-5-phenyl-2,5-dihydro-1λ6-benzothiepin-4-one |
| SMILES | CCCC[C@]1(CC)CS(=O)(=O)c2ccccc2C(c2ccccc2)C1=O |
| InChI | InChI=1S/C22H26O3S/c1-3-5-15-22(4-2)16-26(24,25)19-14-10-9-13-18(19)20(21(22)23)17-11-7-6-8-12-17/h6-14,20H,3-5,15-16H2,1-2H3/t20?,22-/m1/s1 |
| InChIKey | LIGQWKWCTIVUBI-LWMIZPGFSA-N |
| XLogP | 4.76 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.51 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-3-butyl-3-ethyl-1,1-dioxo-5-phenyl-2,5-dihydro-1λ6-benzothiepin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-butyl-3-ethyl-1,1-dioxo-5-phenyl-2,5-dihydro-1λ6-benzothiepin-4-one?
The IUPAC name of (3S)-3-butyl-3-ethyl-1,1-dioxo-5-phenyl-2,5-dihydro-1λ6-benzothiepin-4-one (CID 90901028) is (3S)-3-butyl-3-ethyl-1,1-dioxo-5-phenyl-2,5-dihydro-1λ6-benzothiepin-4-one.
What is the SMILES notation for (3S)-3-butyl-3-ethyl-1,1-dioxo-5-phenyl-2,5-dihydro-1λ6-benzothiepin-4-one?
The canonical SMILES for (3S)-3-butyl-3-ethyl-1,1-dioxo-5-phenyl-2,5-dihydro-1λ6-benzothiepin-4-one is CCCC[C@]1(CC)CS(=O)(=O)c2ccccc2C(c2ccccc2)C1=O.
What is the InChIKey of (3S)-3-butyl-3-ethyl-1,1-dioxo-5-phenyl-2,5-dihydro-1λ6-benzothiepin-4-one?
The InChIKey is LIGQWKWCTIVUBI-LWMIZPGFSA-N. The full InChI is InChI=1S/C22H26O3S/c1-3-5-15-22(4-2)16-26(24,25)19-14-10-9-13-18(19)20(21(22)23)17-11-7-6-8-12-17/h6-14,20H,3-5,15-16H2,1-2H3/t20?,22-/m1/s1.
What are the key properties of (3S)-3-butyl-3-ethyl-1,1-dioxo-5-phenyl-2,5-dihydro-1λ6-benzothiepin-4-one?
(3S)-3-butyl-3-ethyl-1,1-dioxo-5-phenyl-2,5-dihydro-1λ6-benzothiepin-4-one has a molecular weight of 370.51 g/mol, XLogP of 4.76, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-butyl-3-ethyl-1,1-dioxo-5-phenyl-2,5-dihydro-1λ6-benzothiepin-4-one is sourced from PubChem (CID 90901028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).