C20H35IO3Si — CID 90901344
ethyl (5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-10-iodo-6,8-dimethyldeca-2,7,9-trienoate (PubChem CID 90901344) has the molecular formula C20H35IO3Si and a molecular weight of 478.49 g/mol. Its IUPAC name is ethyl (5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-10-iodo-6,8-dimethyldeca-2,7,9-trienoate.
| Compound Name | ethyl (5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-10-iodo-6,8-dimethyldeca-2,7,9-trienoate |
|---|---|
| PubChem CID | 90901344 |
| Molecular Formula | C20H35IO3Si |
| Molecular Weight | 478.49 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | ethyl (5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-10-iodo-6,8-dimethyldeca-2,7,9-trienoate |
| SMILES | CCOC(=O)C=CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C=C(C)C=CI |
| InChI | InChI=1S/C20H35IO3Si/c1-9-23-19(22)12-10-11-18(17(3)15-16(2)13-14-21)24-25(7,8)20(4,5)6/h10,12-15,17-18H,9,11H2,1-8H3/t17-,18-/m0/s1 |
| InChIKey | SLKIYUJMMOQBGL-ROUUACIJSA-N |
| XLogP | 6.42 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.49 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|