About 6-ethylsulfanyl-1,1-difluorohex-1-ene
6-ethylsulfanyl-1,1-difluorohex-1-ene (PubChem CID 90901673) has the molecular formula C8H14F2S
and a molecular weight of 180.26 g/mol. Its IUPAC name is 6-ethylsulfanyl-1,1-difluorohex-1-ene.
Molecular Properties
| Compound Name | 6-ethylsulfanyl-1,1-difluorohex-1-ene |
| PubChem CID | 90901673 |
| Molecular Formula | C8H14F2S |
| Molecular Weight | 180.26 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 6-ethylsulfanyl-1,1-difluorohex-1-ene |
| SMILES | CCSCCCCC=C(F)F |
| InChI | InChI=1S/C8H14F2S/c1-2-11-7-5-3-4-6-8(9)10/h6H,2-5,7H2,1H3 |
| InChIKey | KXGKORJTSIMHDA-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.26 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-ethylsulfanyl-1,1-difluorohex-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethylsulfanyl-1,1-difluorohex-1-ene?
The IUPAC name of 6-ethylsulfanyl-1,1-difluorohex-1-ene (CID 90901673) is 6-ethylsulfanyl-1,1-difluorohex-1-ene.
What is the SMILES notation for 6-ethylsulfanyl-1,1-difluorohex-1-ene?
The canonical SMILES for 6-ethylsulfanyl-1,1-difluorohex-1-ene is CCSCCCCC=C(F)F.
What is the InChIKey of 6-ethylsulfanyl-1,1-difluorohex-1-ene?
The InChIKey is KXGKORJTSIMHDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F2S/c1-2-11-7-5-3-4-6-8(9)10/h6H,2-5,7H2,1H3.
What are the key properties of 6-ethylsulfanyl-1,1-difluorohex-1-ene?
6-ethylsulfanyl-1,1-difluorohex-1-ene has a molecular weight of 180.26 g/mol, XLogP of 3.69, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethylsulfanyl-1,1-difluorohex-1-ene is sourced from PubChem (CID 90901673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).