C21H27NO5S — CID 90901713
methyl 2-(4-tert-butylphenyl)sulfonyl-6-oxo-3,5,7,8-tetrahydro-1H-isoquinoline-8a-carboxylate (PubChem CID 90901713) has the molecular formula C21H27NO5S and a molecular weight of 405.52 g/mol. Its IUPAC name is methyl 2-(4-tert-butylphenyl)sulfonyl-6-oxo-3,5,7,8-tetrahydro-1H-isoquinoline-8a-carboxylate.
| Compound Name | methyl 2-(4-tert-butylphenyl)sulfonyl-6-oxo-3,5,7,8-tetrahydro-1H-isoquinoline-8a-carboxylate |
|---|---|
| PubChem CID | 90901713 |
| Molecular Formula | C21H27NO5S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | methyl 2-(4-tert-butylphenyl)sulfonyl-6-oxo-3,5,7,8-tetrahydro-1H-isoquinoline-8a-carboxylate |
| SMILES | COC(=O)C12CCC(=O)CC1=CCN(S(=O)(=O)c1ccc(C(C)(C)C)cc1)C2 |
| InChI | InChI=1S/C21H27NO5S/c1-20(2,3)15-5-7-18(8-6-15)28(25,26)22-12-10-16-13-17(23)9-11-21(16,14-22)19(24)27-4/h5-8,10H,9,11-14H2,1-4H3 |
| InChIKey | DKYQMKBPWZLZQB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|