About 4-bromo-3-(1,3-dioxolan-2-yl)phenol;ethane
4-bromo-3-(1,3-dioxolan-2-yl)phenol;ethane (PubChem CID 90901779) has the molecular formula C11H15BrO3
and a molecular weight of 275.14 g/mol. Its IUPAC name is 4-bromo-3-(1,3-dioxolan-2-yl)phenol;ethane.
Molecular Properties
| Compound Name | 4-bromo-3-(1,3-dioxolan-2-yl)phenol;ethane |
| PubChem CID | 90901779 |
| Molecular Formula | C11H15BrO3 |
| Molecular Weight | 275.14 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 4-bromo-3-(1,3-dioxolan-2-yl)phenol;ethane |
| SMILES | CC.Oc1ccc(Br)c(C2OCCO2)c1 |
| InChI | InChI=1S/C9H9BrO3.C2H6/c10-8-2-1-6(11)5-7(8)9-12-3-4-13-9;1-2/h1-2,5,9,11H,3-4H2;1-2H3 |
| InChIKey | UGPGJDXFRYGGJW-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.14 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-bromo-3-(1,3-dioxolan-2-yl)phenol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-3-(1,3-dioxolan-2-yl)phenol;ethane?
The IUPAC name of 4-bromo-3-(1,3-dioxolan-2-yl)phenol;ethane (CID 90901779) is 4-bromo-3-(1,3-dioxolan-2-yl)phenol;ethane.
What is the SMILES notation for 4-bromo-3-(1,3-dioxolan-2-yl)phenol;ethane?
The canonical SMILES for 4-bromo-3-(1,3-dioxolan-2-yl)phenol;ethane is CC.Oc1ccc(Br)c(C2OCCO2)c1.
What is the InChIKey of 4-bromo-3-(1,3-dioxolan-2-yl)phenol;ethane?
The InChIKey is UGPGJDXFRYGGJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrO3.C2H6/c10-8-2-1-6(11)5-7(8)9-12-3-4-13-9;1-2/h1-2,5,9,11H,3-4H2;1-2H3.
What are the key properties of 4-bromo-3-(1,3-dioxolan-2-yl)phenol;ethane?
4-bromo-3-(1,3-dioxolan-2-yl)phenol;ethane has a molecular weight of 275.14 g/mol, XLogP of 3.23, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-3-(1,3-dioxolan-2-yl)phenol;ethane is sourced from PubChem (CID 90901779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).