About 4-ethyl-5-(2-fluorophenyl)-1-(3-imidazol-1-ylpropyl)pyrrole-2,3-diol
4-ethyl-5-(2-fluorophenyl)-1-(3-imidazol-1-ylpropyl)pyrrole-2,3-diol (PubChem CID 90901969) has the molecular formula C18H20FN3O2
and a molecular weight of 329.38 g/mol. Its IUPAC name is 4-ethyl-5-(2-fluorophenyl)-1-(3-imidazol-1-ylpropyl)pyrrole-2,3-diol.
Molecular Properties
| Compound Name | 4-ethyl-5-(2-fluorophenyl)-1-(3-imidazol-1-ylpropyl)pyrrole-2,3-diol |
| PubChem CID | 90901969 |
| Molecular Formula | C18H20FN3O2 |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 4-ethyl-5-(2-fluorophenyl)-1-(3-imidazol-1-ylpropyl)pyrrole-2,3-diol |
| SMILES | CCc1c(O)c(O)n(CCCn2ccnc2)c1-c1ccccc1F |
| InChI | InChI=1S/C18H20FN3O2/c1-2-13-16(14-6-3-4-7-15(14)19)22(18(24)17(13)23)10-5-9-21-11-8-20-12-21/h3-4,6-8,11-12,23-24H,2,5,9-10H2,1H3 |
| InChIKey | BAVXTBPDRMBCNT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 63.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-ethyl-5-(2-fluorophenyl)-1-(3-imidazol-1-ylpropyl)pyrrole-2,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-5-(2-fluorophenyl)-1-(3-imidazol-1-ylpropyl)pyrrole-2,3-diol?
The IUPAC name of 4-ethyl-5-(2-fluorophenyl)-1-(3-imidazol-1-ylpropyl)pyrrole-2,3-diol (CID 90901969) is 4-ethyl-5-(2-fluorophenyl)-1-(3-imidazol-1-ylpropyl)pyrrole-2,3-diol.
What is the SMILES notation for 4-ethyl-5-(2-fluorophenyl)-1-(3-imidazol-1-ylpropyl)pyrrole-2,3-diol?
The canonical SMILES for 4-ethyl-5-(2-fluorophenyl)-1-(3-imidazol-1-ylpropyl)pyrrole-2,3-diol is CCc1c(O)c(O)n(CCCn2ccnc2)c1-c1ccccc1F.
What is the InChIKey of 4-ethyl-5-(2-fluorophenyl)-1-(3-imidazol-1-ylpropyl)pyrrole-2,3-diol?
The InChIKey is BAVXTBPDRMBCNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20FN3O2/c1-2-13-16(14-6-3-4-7-15(14)19)22(18(24)17(13)23)10-5-9-21-11-8-20-12-21/h3-4,6-8,11-12,23-24H,2,5,9-10H2,1H3.
What are the key properties of 4-ethyl-5-(2-fluorophenyl)-1-(3-imidazol-1-ylpropyl)pyrrole-2,3-diol?
4-ethyl-5-(2-fluorophenyl)-1-(3-imidazol-1-ylpropyl)pyrrole-2,3-diol has a molecular weight of 329.38 g/mol, XLogP of 3.55, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-5-(2-fluorophenyl)-1-(3-imidazol-1-ylpropyl)pyrrole-2,3-diol is sourced from PubChem (CID 90901969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).