C28H40N8 — CID 90901979
N-cyclohexa-1,3-dien-1-yl-2-[[5-[(4E)-hepta-2,4-dien-4-yl]-1H-pyrazol-3-yl]imino]-N,5-dimethyl-7-(4-methylpiperazin-1-yl)-5,6-dihydro-1,3-diazepin-4-amine (PubChem CID 90901979) has the molecular formula C28H40N8 and a molecular weight of 488.68 g/mol. Its IUPAC name is N-cyclohexa-1,3-dien-1-yl-2-[[5-[(4E)-hepta-2,4-dien-4-yl]-1H-pyrazol-3-yl]imino]-N,5-dimethyl-7-(4-methylpiperazin-1-yl)-5,6-dihydro-1,3-diazepin-4-amine.
| Compound Name | N-cyclohexa-1,3-dien-1-yl-2-[[5-[(4E)-hepta-2,4-dien-4-yl]-1H-pyrazol-3-yl]imino]-N,5-dimethyl-7-(4-methylpiperazin-1-yl)-5,6-dihydro-1,3-diazepin-4-amine |
|---|---|
| PubChem CID | 90901979 |
| Molecular Formula | C28H40N8 |
| Molecular Weight | 488.68 g/mol |
| Exact Mass | 488.34 |
| IUPAC Name | N-cyclohexa-1,3-dien-1-yl-2-[[5-[(4E)-hepta-2,4-dien-4-yl]-1H-pyrazol-3-yl]imino]-N,5-dimethyl-7-(4-methylpiperazin-1-yl)-5,6-dihydro-1,3-diazepin-4-amine |
| SMILES | CC=C/C(=C\CC)c1cc(/N=C2\N=C(N3CCN(C)CC3)CC(C)C(N(C)C3=CC=CCC3)=N2)n[nH]1 |
| InChI | InChI=1S/C28H40N8/c1-6-11-22(12-7-2)24-20-25(33-32-24)29-28-30-26(36-17-15-34(4)16-18-36)19-21(3)27(31-28)35(5)23-13-9-8-10-14-23/h6,8-9,11-13,20-21H,7,10,14-19H2,1-5H3,(H,32,33)/b11-6?,22-12+,29-28+ |
| InChIKey | WEGVZRXFGSQUTG-JIOHIAJHSA-N |
| XLogP | 5.02 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.68 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|