C25H27F2N3O3 — CID 90902206
2-[(2R,3S)-3-amino-4-(3,5-difluorophenyl)-1-[(3-ethylphenyl)methylamino]butan-2-yl]-1-oxidopyridin-1-ium-3-carboxylic acid (PubChem CID 90902206) has the molecular formula C25H27F2N3O3 and a molecular weight of 455.51 g/mol. Its IUPAC name is 2-[(2R,3S)-3-amino-4-(3,5-difluorophenyl)-1-[(3-ethylphenyl)methylamino]butan-2-yl]-1-oxidopyridin-1-ium-3-carboxylic acid.
| Compound Name | 2-[(2R,3S)-3-amino-4-(3,5-difluorophenyl)-1-[(3-ethylphenyl)methylamino]butan-2-yl]-1-oxidopyridin-1-ium-3-carboxylic acid |
|---|---|
| PubChem CID | 90902206 |
| Molecular Formula | C25H27F2N3O3 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | 2-[(2R,3S)-3-amino-4-(3,5-difluorophenyl)-1-[(3-ethylphenyl)methylamino]butan-2-yl]-1-oxidopyridin-1-ium-3-carboxylic acid |
| SMILES | CCc1cccc(CNC[C@@H](c2c(C(=O)O)ccc[n+]2[O-])[C@@H](N)Cc2cc(F)cc(F)c2)c1 |
| InChI | InChI=1S/C25H27F2N3O3/c1-2-16-5-3-6-17(9-16)14-29-15-22(24-21(25(31)32)7-4-8-30(24)33)23(28)12-18-10-19(26)13-20(27)11-18/h3-11,13,22-23,29H,2,12,14-15,28H2,1H3,(H,31,32)/t22-,23+/m1/s1 |
| InChIKey | LWRSQKORQQCENV-PKTZIBPZSA-N |
| XLogP | 3.30 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|