C21H21F4N3O2S — CID 90902212
5-(4-fluorophenyl)-1-methyl-3-[3-[2-[sulfino(2,2,2-trifluoroethyl)amino]propan-2-yl]phenyl]pyrazole (PubChem CID 90902212) has the molecular formula C21H21F4N3O2S and a molecular weight of 455.48 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-1-methyl-3-[3-[2-[sulfino(2,2,2-trifluoroethyl)amino]propan-2-yl]phenyl]pyrazole.
| Compound Name | 5-(4-fluorophenyl)-1-methyl-3-[3-[2-[sulfino(2,2,2-trifluoroethyl)amino]propan-2-yl]phenyl]pyrazole |
|---|---|
| PubChem CID | 90902212 |
| Molecular Formula | C21H21F4N3O2S |
| Molecular Weight | 455.48 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | 5-(4-fluorophenyl)-1-methyl-3-[3-[2-[sulfino(2,2,2-trifluoroethyl)amino]propan-2-yl]phenyl]pyrazole |
| SMILES | Cn1nc(-c2cccc(C(C)(C)N(CC(F)(F)F)S(=O)O)c2)cc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C21H21F4N3O2S/c1-20(2,28(31(29)30)13-21(23,24)25)16-6-4-5-15(11-16)18-12-19(27(3)26-18)14-7-9-17(22)10-8-14/h4-12H,13H2,1-3H3,(H,29,30) |
| InChIKey | UTLGATVZPMIPQR-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.48 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|