About 1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl N-[(4-tert-butylphenyl)methyl]carbamate
1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl N-[(4-tert-butylphenyl)methyl]carbamate (PubChem CID 90902219) has the molecular formula C19H27N3O3
and a molecular weight of 345.44 g/mol. Its IUPAC name is 1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl N-[(4-tert-butylphenyl)methyl]carbamate.
Molecular Properties
| Compound Name | 1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl N-[(4-tert-butylphenyl)methyl]carbamate |
| PubChem CID | 90902219 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | 1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl N-[(4-tert-butylphenyl)methyl]carbamate |
| SMILES | CC(C)(C)c1ccc(CNC(=O)OC2=CC3(CCNCC3)ON2)cc1 |
| InChI | InChI=1S/C19H27N3O3/c1-18(2,3)15-6-4-14(5-7-15)13-21-17(23)24-16-12-19(25-22-16)8-10-20-11-9-19/h4-7,12,20,22H,8-11,13H2,1-3H3,(H,21,23) |
| InChIKey | QLFPHHLLHYBMOP-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl N-[(4-tert-butylphenyl)methyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl N-[(4-tert-butylphenyl)methyl]carbamate?
The IUPAC name of 1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl N-[(4-tert-butylphenyl)methyl]carbamate (CID 90902219) is 1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl N-[(4-tert-butylphenyl)methyl]carbamate.
What is the SMILES notation for 1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl N-[(4-tert-butylphenyl)methyl]carbamate?
The canonical SMILES for 1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl N-[(4-tert-butylphenyl)methyl]carbamate is CC(C)(C)c1ccc(CNC(=O)OC2=CC3(CCNCC3)ON2)cc1.
What is the InChIKey of 1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl N-[(4-tert-butylphenyl)methyl]carbamate?
The InChIKey is QLFPHHLLHYBMOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27N3O3/c1-18(2,3)15-6-4-14(5-7-15)13-21-17(23)24-16-12-19(25-22-16)8-10-20-11-9-19/h4-7,12,20,22H,8-11,13H2,1-3H3,(H,21,23).
What are the key properties of 1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl N-[(4-tert-butylphenyl)methyl]carbamate?
1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl N-[(4-tert-butylphenyl)methyl]carbamate has a molecular weight of 345.44 g/mol, XLogP of 2.71, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl N-[(4-tert-butylphenyl)methyl]carbamate is sourced from PubChem (CID 90902219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).