C26H29FN2OS — CID 90902257
3-[1-[4-(2,4-dimethyl-1,3-thiazol-5-yl)phenyl]ethyl]-6-(4-fluorophenyl)-6-prop-2-enyl-1,3-oxazinane (PubChem CID 90902257) has the molecular formula C26H29FN2OS and a molecular weight of 436.60 g/mol. Its IUPAC name is 3-[1-[4-(2,4-dimethyl-1,3-thiazol-5-yl)phenyl]ethyl]-6-(4-fluorophenyl)-6-prop-2-enyl-1,3-oxazinane.
| Compound Name | 3-[1-[4-(2,4-dimethyl-1,3-thiazol-5-yl)phenyl]ethyl]-6-(4-fluorophenyl)-6-prop-2-enyl-1,3-oxazinane |
|---|---|
| PubChem CID | 90902257 |
| Molecular Formula | C26H29FN2OS |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 3-[1-[4-(2,4-dimethyl-1,3-thiazol-5-yl)phenyl]ethyl]-6-(4-fluorophenyl)-6-prop-2-enyl-1,3-oxazinane |
| SMILES | C=CCC1(c2ccc(F)cc2)CCN(C(C)c2ccc(-c3sc(C)nc3C)cc2)CO1 |
| InChI | InChI=1S/C26H29FN2OS/c1-5-14-26(23-10-12-24(27)13-11-23)15-16-29(17-30-26)19(3)21-6-8-22(9-7-21)25-18(2)28-20(4)31-25/h5-13,19H,1,14-17H2,2-4H3 |
| InChIKey | SNGLNEKMUCRWIA-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|