About 6-benzyl-3H-thieno[2,3-b][1,4]thiazine
6-benzyl-3H-thieno[2,3-b][1,4]thiazine (PubChem CID 90902293) has the molecular formula C13H11NS2
and a molecular weight of 245.37 g/mol. Its IUPAC name is 6-benzyl-3H-thieno[2,3-b][1,4]thiazine.
Molecular Properties
| Compound Name | 6-benzyl-3H-thieno[2,3-b][1,4]thiazine |
| PubChem CID | 90902293 |
| Molecular Formula | C13H11NS2 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.03 |
| IUPAC Name | 6-benzyl-3H-thieno[2,3-b][1,4]thiazine |
| SMILES | C1=Nc2cc(Cc3ccccc3)sc2SC1 |
| InChI | InChI=1S/C13H11NS2/c1-2-4-10(5-3-1)8-11-9-12-13(16-11)15-7-6-14-12/h1-6,9H,7-8H2 |
| InChIKey | ULAZKMWFKOLFIX-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-benzyl-3H-thieno[2,3-b][1,4]thiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-benzyl-3H-thieno[2,3-b][1,4]thiazine?
The IUPAC name of 6-benzyl-3H-thieno[2,3-b][1,4]thiazine (CID 90902293) is 6-benzyl-3H-thieno[2,3-b][1,4]thiazine.
What is the SMILES notation for 6-benzyl-3H-thieno[2,3-b][1,4]thiazine?
The canonical SMILES for 6-benzyl-3H-thieno[2,3-b][1,4]thiazine is C1=Nc2cc(Cc3ccccc3)sc2SC1.
What is the InChIKey of 6-benzyl-3H-thieno[2,3-b][1,4]thiazine?
The InChIKey is ULAZKMWFKOLFIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NS2/c1-2-4-10(5-3-1)8-11-9-12-13(16-11)15-7-6-14-12/h1-6,9H,7-8H2.
What are the key properties of 6-benzyl-3H-thieno[2,3-b][1,4]thiazine?
6-benzyl-3H-thieno[2,3-b][1,4]thiazine has a molecular weight of 245.37 g/mol, XLogP of 4.15, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-benzyl-3H-thieno[2,3-b][1,4]thiazine is sourced from PubChem (CID 90902293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).