About (E)-4-(2,3-dihydrofuran-2-yl)-3-methylbut-3-enal
(E)-4-(2,3-dihydrofuran-2-yl)-3-methylbut-3-enal (PubChem CID 90902446) has the molecular formula C9H12O2
and a molecular weight of 152.19 g/mol. Its IUPAC name is (E)-4-(2,3-dihydrofuran-2-yl)-3-methylbut-3-enal.
Molecular Properties
| Compound Name | (E)-4-(2,3-dihydrofuran-2-yl)-3-methylbut-3-enal |
| PubChem CID | 90902446 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | (E)-4-(2,3-dihydrofuran-2-yl)-3-methylbut-3-enal |
| SMILES | C/C(=C\C1CC=CO1)CC=O |
| InChI | InChI=1S/C9H12O2/c1-8(4-5-10)7-9-3-2-6-11-9/h2,5-7,9H,3-4H2,1H3/b8-7+ |
| InChIKey | GNCVGXXVZRNNHT-BQYQJAHWSA-N |
| XLogP | 1.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-(2,3-dihydrofuran-2-yl)-3-methylbut-3-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-(2,3-dihydrofuran-2-yl)-3-methylbut-3-enal?
The IUPAC name of (E)-4-(2,3-dihydrofuran-2-yl)-3-methylbut-3-enal (CID 90902446) is (E)-4-(2,3-dihydrofuran-2-yl)-3-methylbut-3-enal.
What is the SMILES notation for (E)-4-(2,3-dihydrofuran-2-yl)-3-methylbut-3-enal?
The canonical SMILES for (E)-4-(2,3-dihydrofuran-2-yl)-3-methylbut-3-enal is C/C(=C\C1CC=CO1)CC=O.
What is the InChIKey of (E)-4-(2,3-dihydrofuran-2-yl)-3-methylbut-3-enal?
The InChIKey is GNCVGXXVZRNNHT-BQYQJAHWSA-N. The full InChI is InChI=1S/C9H12O2/c1-8(4-5-10)7-9-3-2-6-11-9/h2,5-7,9H,3-4H2,1H3/b8-7+.
What are the key properties of (E)-4-(2,3-dihydrofuran-2-yl)-3-methylbut-3-enal?
(E)-4-(2,3-dihydrofuran-2-yl)-3-methylbut-3-enal has a molecular weight of 152.19 g/mol, XLogP of 1.82, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-(2,3-dihydrofuran-2-yl)-3-methylbut-3-enal is sourced from PubChem (CID 90902446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).