About 6-[4-[3,3-bis(4-chlorophenyl)propyl]piperazin-1-yl]-2-cyclohexylisoindol-1-ol
6-[4-[3,3-bis(4-chlorophenyl)propyl]piperazin-1-yl]-2-cyclohexylisoindol-1-ol (PubChem CID 90902745) has the molecular formula C33H37Cl2N3O
and a molecular weight of 562.59 g/mol. Its IUPAC name is 6-[4-[3,3-bis(4-chlorophenyl)propyl]piperazin-1-yl]-2-cyclohexylisoindol-1-ol.
Molecular Properties
| Compound Name | 6-[4-[3,3-bis(4-chlorophenyl)propyl]piperazin-1-yl]-2-cyclohexylisoindol-1-ol |
| PubChem CID | 90902745 |
| Molecular Formula | C33H37Cl2N3O |
| Molecular Weight | 562.59 g/mol |
| Exact Mass | 561.23 |
| IUPAC Name | 6-[4-[3,3-bis(4-chlorophenyl)propyl]piperazin-1-yl]-2-cyclohexylisoindol-1-ol |
| SMILES | Oc1c2cc(N3CCN(CCC(c4ccc(Cl)cc4)c4ccc(Cl)cc4)CC3)ccc2cn1C1CCCCC1 |
| InChI | InChI=1S/C33H37Cl2N3O/c34-27-11-6-24(7-12-27)31(25-8-13-28(35)14-9-25)16-17-36-18-20-37(21-19-36)30-15-10-26-23-38(33(39)32(26)22-30)29-4-2-1-3-5-29/h6-15,22-23,29,31,39H,1-5,16-21H2 |
| InChIKey | FTRDWWBIYJRYEM-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 31.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 562.59 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[4-[3,3-bis(4-chlorophenyl)propyl]piperazin-1-yl]-2-cyclohexylisoindol-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-[3,3-bis(4-chlorophenyl)propyl]piperazin-1-yl]-2-cyclohexylisoindol-1-ol?
The IUPAC name of 6-[4-[3,3-bis(4-chlorophenyl)propyl]piperazin-1-yl]-2-cyclohexylisoindol-1-ol (CID 90902745) is 6-[4-[3,3-bis(4-chlorophenyl)propyl]piperazin-1-yl]-2-cyclohexylisoindol-1-ol.
What is the SMILES notation for 6-[4-[3,3-bis(4-chlorophenyl)propyl]piperazin-1-yl]-2-cyclohexylisoindol-1-ol?
The canonical SMILES for 6-[4-[3,3-bis(4-chlorophenyl)propyl]piperazin-1-yl]-2-cyclohexylisoindol-1-ol is Oc1c2cc(N3CCN(CCC(c4ccc(Cl)cc4)c4ccc(Cl)cc4)CC3)ccc2cn1C1CCCCC1.
What is the InChIKey of 6-[4-[3,3-bis(4-chlorophenyl)propyl]piperazin-1-yl]-2-cyclohexylisoindol-1-ol?
The InChIKey is FTRDWWBIYJRYEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H37Cl2N3O/c34-27-11-6-24(7-12-27)31(25-8-13-28(35)14-9-25)16-17-36-18-20-37(21-19-36)30-15-10-26-23-38(33(39)32(26)22-30)29-4-2-1-3-5-29/h6-15,22-23,29,31,39H,1-5,16-21H2.
What are the key properties of 6-[4-[3,3-bis(4-chlorophenyl)propyl]piperazin-1-yl]-2-cyclohexylisoindol-1-ol?
6-[4-[3,3-bis(4-chlorophenyl)propyl]piperazin-1-yl]-2-cyclohexylisoindol-1-ol has a molecular weight of 562.59 g/mol, XLogP of 8.50, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-[3,3-bis(4-chlorophenyl)propyl]piperazin-1-yl]-2-cyclohexylisoindol-1-ol is sourced from PubChem (CID 90902745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).