C23H40O4 — CID 90903026
2-pentadec-8-enyl-2,3,4,5-tetrahydro-1-benzofuran-3a,5,7a-triol (PubChem CID 90903026) has the molecular formula C23H40O4 and a molecular weight of 380.57 g/mol. Its IUPAC name is 2-pentadec-8-enyl-2,3,4,5-tetrahydro-1-benzofuran-3a,5,7a-triol.
| Compound Name | 2-pentadec-8-enyl-2,3,4,5-tetrahydro-1-benzofuran-3a,5,7a-triol |
|---|---|
| PubChem CID | 90903026 |
| Molecular Formula | C23H40O4 |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 380.29 |
| IUPAC Name | 2-pentadec-8-enyl-2,3,4,5-tetrahydro-1-benzofuran-3a,5,7a-triol |
| SMILES | CCCCCCC=CCCCCCCCC1CC2(O)CC(O)C=CC2(O)O1 |
| InChI | InChI=1S/C23H40O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-21-19-22(25)18-20(24)16-17-23(22,26)27-21/h7-8,16-17,20-21,24-26H,2-6,9-15,18-19H2,1H3 |
| InChIKey | IJRSKVZMCCBYIY-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|