C17H28N2O7 — CID 90903140
(2,5-dihydroxypyrrol-1-yl) (2S)-4-methyl-2-[2-[(2-methylpropan-2-yl)oxy]ethoxycarbonylamino]pentanoate (PubChem CID 90903140) has the molecular formula C17H28N2O7 and a molecular weight of 372.42 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) (2S)-4-methyl-2-[2-[(2-methylpropan-2-yl)oxy]ethoxycarbonylamino]pentanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) (2S)-4-methyl-2-[2-[(2-methylpropan-2-yl)oxy]ethoxycarbonylamino]pentanoate |
|---|---|
| PubChem CID | 90903140 |
| Molecular Formula | C17H28N2O7 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) (2S)-4-methyl-2-[2-[(2-methylpropan-2-yl)oxy]ethoxycarbonylamino]pentanoate |
| SMILES | CC(C)C[C@H](NC(=O)OCCOC(C)(C)C)C(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C17H28N2O7/c1-11(2)10-12(15(22)26-19-13(20)6-7-14(19)21)18-16(23)24-8-9-25-17(3,4)5/h6-7,11-12,20-21H,8-10H2,1-5H3,(H,18,23)/t12-/m0/s1 |
| InChIKey | FXBDKPLTMGHMNH-LBPRGKRZSA-N |
| XLogP | 1.81 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|