About 3-fluoro-1-methyl-2,5-dihydropyrrole
3-fluoro-1-methyl-2,5-dihydropyrrole (PubChem CID 90903503) has the molecular formula C5H8FN
and a molecular weight of 101.12 g/mol. Its IUPAC name is 3-fluoro-1-methyl-2,5-dihydropyrrole.
Molecular Properties
| Compound Name | 3-fluoro-1-methyl-2,5-dihydropyrrole |
| PubChem CID | 90903503 |
| Molecular Formula | C5H8FN |
| Molecular Weight | 101.12 g/mol |
| Exact Mass | 101.06 |
| IUPAC Name | 3-fluoro-1-methyl-2,5-dihydropyrrole |
| SMILES | CN1CC=C(F)C1 |
| InChI | InChI=1S/C5H8FN/c1-7-3-2-5(6)4-7/h2H,3-4H2,1H3 |
| InChIKey | MFHPTLYEZWABNE-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.12 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-fluoro-1-methyl-2,5-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-1-methyl-2,5-dihydropyrrole?
The IUPAC name of 3-fluoro-1-methyl-2,5-dihydropyrrole (CID 90903503) is 3-fluoro-1-methyl-2,5-dihydropyrrole.
What is the SMILES notation for 3-fluoro-1-methyl-2,5-dihydropyrrole?
The canonical SMILES for 3-fluoro-1-methyl-2,5-dihydropyrrole is CN1CC=C(F)C1.
What is the InChIKey of 3-fluoro-1-methyl-2,5-dihydropyrrole?
The InChIKey is MFHPTLYEZWABNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8FN/c1-7-3-2-5(6)4-7/h2H,3-4H2,1H3.
What are the key properties of 3-fluoro-1-methyl-2,5-dihydropyrrole?
3-fluoro-1-methyl-2,5-dihydropyrrole has a molecular weight of 101.12 g/mol, XLogP of 0.79, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-1-methyl-2,5-dihydropyrrole is sourced from PubChem (CID 90903503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).