C18H36N6O — CID 90903647
4-[3-(4-methylpiperazin-1-yl)-2-piperazin-1-ylpiperidin-2-yl]morpholine (PubChem CID 90903647) has the molecular formula C18H36N6O and a molecular weight of 352.53 g/mol. Its IUPAC name is 4-[3-(4-methylpiperazin-1-yl)-2-piperazin-1-ylpiperidin-2-yl]morpholine.
| Compound Name | 4-[3-(4-methylpiperazin-1-yl)-2-piperazin-1-ylpiperidin-2-yl]morpholine |
|---|---|
| PubChem CID | 90903647 |
| Molecular Formula | C18H36N6O |
| Molecular Weight | 352.53 g/mol |
| Exact Mass | 352.30 |
| IUPAC Name | 4-[3-(4-methylpiperazin-1-yl)-2-piperazin-1-ylpiperidin-2-yl]morpholine |
| SMILES | CN1CCN(C2CCCNC2(N2CCNCC2)N2CCOCC2)CC1 |
| InChI | InChI=1S/C18H36N6O/c1-21-9-11-22(12-10-21)17-3-2-4-20-18(17,23-7-5-19-6-8-23)24-13-15-25-16-14-24/h17,19-20H,2-16H2,1H3 |
| InChIKey | IPPPGOXRAWHQPI-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.53 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |