C12H10N4 — CID 90903828
4-(3,4-diiminocyclohexa-1,5-dien-1-yl)cyclohexa-3,5-diene-1,2-diimine (PubChem CID 90903828) has the molecular formula C12H10N4 and a molecular weight of 210.24 g/mol. Its IUPAC name is 4-(3,4-diiminocyclohexa-1,5-dien-1-yl)cyclohexa-3,5-diene-1,2-diimine.
| Compound Name | 4-(3,4-diiminocyclohexa-1,5-dien-1-yl)cyclohexa-3,5-diene-1,2-diimine |
|---|---|
| PubChem CID | 90903828 |
| Molecular Formula | C12H10N4 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 4-(3,4-diiminocyclohexa-1,5-dien-1-yl)cyclohexa-3,5-diene-1,2-diimine |
| SMILES | [H]/N=C1/C=C(C2=CC(=N/[H])/C(=N/[H])C=C2)C=C/C1=N\[H] |
| InChI | InChI=1S/C12H10N4/c13-9-3-1-7(5-11(9)15)8-2-4-10(14)12(16)6-8/h1-6,13-16H/b13-9+,14-10+,15-11-,16-12- |
| InChIKey | FMQPPCRBCDQQIP-YDUSYTMISA-N |
| XLogP | 2.06 |
| TPSA | 95.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|