C29H35N4S4+ — CID 90904125
4-[2-(2,3-dihydro-1,3-thiazol-2-yl)ethenyl]-N-methyl-N-[2-[2-[N-methyl-4-[2-(3-methyl-1,3-thiazol-3-ium-2-yl)ethenyl]anilino]ethyldisulfanyl]ethyl]aniline (PubChem CID 90904125) has the molecular formula C29H35N4S4+ and a molecular weight of 567.90 g/mol. Its IUPAC name is 4-[2-(2,3-dihydro-1,3-thiazol-2-yl)ethenyl]-N-methyl-N-[2-[2-[N-methyl-4-[2-(3-methyl-1,3-thiazol-3-ium-2-yl)ethenyl]anilino]ethyldisulfanyl]ethyl]aniline.
| Compound Name | 4-[2-(2,3-dihydro-1,3-thiazol-2-yl)ethenyl]-N-methyl-N-[2-[2-[N-methyl-4-[2-(3-methyl-1,3-thiazol-3-ium-2-yl)ethenyl]anilino]ethyldisulfanyl]ethyl]aniline |
|---|---|
| PubChem CID | 90904125 |
| Molecular Formula | C29H35N4S4+ |
| Molecular Weight | 567.90 g/mol |
| Exact Mass | 567.17 |
| IUPAC Name | 4-[2-(2,3-dihydro-1,3-thiazol-2-yl)ethenyl]-N-methyl-N-[2-[2-[N-methyl-4-[2-(3-methyl-1,3-thiazol-3-ium-2-yl)ethenyl]anilino]ethyldisulfanyl]ethyl]aniline |
| SMILES | CN(CCSSCCN(C)c1ccc(C=CC2NC=CS2)cc1)c1ccc(C=Cc2scc[n+]2C)cc1 |
| InChI | InChI=1S/C29H35N4S4/c1-31(26-10-4-24(5-11-26)8-14-28-30-16-20-34-28)18-22-36-37-23-19-32(2)27-12-6-25(7-13-27)9-15-29-33(3)17-21-35-29/h4-17,20-21,28,30H,18-19,22-23H2,1-3H3/q+1 |
| InChIKey | PTPOWHYGRPORED-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 22.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.90 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|