C7H11N3O4 — CID 90904164
5-(dihydroxymethyl)-N-ethyl-2-oxo-1H-imidazole-3-carboxamide (PubChem CID 90904164) has the molecular formula C7H11N3O4 and a molecular weight of 201.18 g/mol. Its IUPAC name is 5-(dihydroxymethyl)-N-ethyl-2-oxo-1H-imidazole-3-carboxamide.
| Compound Name | 5-(dihydroxymethyl)-N-ethyl-2-oxo-1H-imidazole-3-carboxamide |
|---|---|
| PubChem CID | 90904164 |
| Molecular Formula | C7H11N3O4 |
| Molecular Weight | 201.18 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | 5-(dihydroxymethyl)-N-ethyl-2-oxo-1H-imidazole-3-carboxamide |
| SMILES | CCNC(=O)n1cc(C(O)O)[nH]c1=O |
| InChI | InChI=1S/C7H11N3O4/c1-2-8-6(13)10-3-4(5(11)12)9-7(10)14/h3,5,11-12H,2H2,1H3,(H,8,13)(H,9,14) |
| InChIKey | NIJNPBJRGLPXIW-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 107.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.18 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|