About ethane;1-hydroxy-3H-2,1-benzoxaborole
ethane;1-hydroxy-3H-2,1-benzoxaborole (PubChem CID 90904169) has the molecular formula C9H13BO2
and a molecular weight of 164.01 g/mol. Its IUPAC name is ethane;1-hydroxy-3H-2,1-benzoxaborole.
Molecular Properties
| Compound Name | ethane;1-hydroxy-3H-2,1-benzoxaborole |
| PubChem CID | 90904169 |
| Molecular Formula | C9H13BO2 |
| Molecular Weight | 164.01 g/mol |
| Exact Mass | 164.10 |
| IUPAC Name | ethane;1-hydroxy-3H-2,1-benzoxaborole |
| SMILES | CC.OB1OCc2ccccc21 |
| InChI | InChI=1S/C7H7BO2.C2H6/c9-8-7-4-2-1-3-6(7)5-10-8;1-2/h1-4,9H,5H2;1-2H3 |
| InChIKey | IUHIPRWINVMUGM-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.01 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-hydroxy-3H-2,1-benzoxaborole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-hydroxy-3H-2,1-benzoxaborole?
The IUPAC name of ethane;1-hydroxy-3H-2,1-benzoxaborole (CID 90904169) is ethane;1-hydroxy-3H-2,1-benzoxaborole.
What is the SMILES notation for ethane;1-hydroxy-3H-2,1-benzoxaborole?
The canonical SMILES for ethane;1-hydroxy-3H-2,1-benzoxaborole is CC.OB1OCc2ccccc21.
What is the InChIKey of ethane;1-hydroxy-3H-2,1-benzoxaborole?
The InChIKey is IUHIPRWINVMUGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7BO2.C2H6/c9-8-7-4-2-1-3-6(7)5-10-8;1-2/h1-4,9H,5H2;1-2H3.
What are the key properties of ethane;1-hydroxy-3H-2,1-benzoxaborole?
ethane;1-hydroxy-3H-2,1-benzoxaborole has a molecular weight of 164.01 g/mol, XLogP of 0.93, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-hydroxy-3H-2,1-benzoxaborole is sourced from PubChem (CID 90904169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).