C21H26N5O2+ — CID 90904260
2-methyl-6-[2-[2-(1-methylpyrrolidin-1-ium-1-yl)ethylamino]pyrazolo[1,5-a]pyridin-3-yl]iminocyclohex-4-ene-1,3-dione (PubChem CID 90904260) has the molecular formula C21H26N5O2+ and a molecular weight of 380.47 g/mol. Its IUPAC name is 2-methyl-6-[2-[2-(1-methylpyrrolidin-1-ium-1-yl)ethylamino]pyrazolo[1,5-a]pyridin-3-yl]iminocyclohex-4-ene-1,3-dione.
| Compound Name | 2-methyl-6-[2-[2-(1-methylpyrrolidin-1-ium-1-yl)ethylamino]pyrazolo[1,5-a]pyridin-3-yl]iminocyclohex-4-ene-1,3-dione |
|---|---|
| PubChem CID | 90904260 |
| Molecular Formula | C21H26N5O2+ |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 2-methyl-6-[2-[2-(1-methylpyrrolidin-1-ium-1-yl)ethylamino]pyrazolo[1,5-a]pyridin-3-yl]iminocyclohex-4-ene-1,3-dione |
| SMILES | CC1C(=O)C=C/C(=N\c2c(NCC[N+]3(C)CCCC3)nn3ccccc23)C1=O |
| InChI | InChI=1S/C21H26N5O2/c1-15-18(27)9-8-16(20(15)28)23-19-17-7-3-4-11-25(17)24-21(19)22-10-14-26(2)12-5-6-13-26/h3-4,7-9,11,15H,5-6,10,12-14H2,1-2H3,(H,22,24)/q+1/b23-16+ |
| InChIKey | HKYAWPGVFSWTIF-XQNSMLJCSA-N |
| XLogP | 2.40 |
| TPSA | 75.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|