C18H29NO2 — CID 90904324
1-(4-hydroxypiperidin-1-yl)-4-(2,4,5-trimethylcyclohexa-1,4-dien-1-yl)butan-1-one (PubChem CID 90904324) has the molecular formula C18H29NO2 and a molecular weight of 291.44 g/mol. Its IUPAC name is 1-(4-hydroxypiperidin-1-yl)-4-(2,4,5-trimethylcyclohexa-1,4-dien-1-yl)butan-1-one.
| Compound Name | 1-(4-hydroxypiperidin-1-yl)-4-(2,4,5-trimethylcyclohexa-1,4-dien-1-yl)butan-1-one |
|---|---|
| PubChem CID | 90904324 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | 1-(4-hydroxypiperidin-1-yl)-4-(2,4,5-trimethylcyclohexa-1,4-dien-1-yl)butan-1-one |
| SMILES | CC1=C(C)CC(CCCC(=O)N2CCC(O)CC2)=C(C)C1 |
| InChI | InChI=1S/C18H29NO2/c1-13-11-15(3)16(12-14(13)2)5-4-6-18(21)19-9-7-17(20)8-10-19/h17,20H,4-12H2,1-3H3 |
| InChIKey | VMSXRXLZSXEBFE-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|