C6H10O5S — CID 90904448
(2S,5S)-1,2,5-trihydroxy-6-sulfanylhexane-3,4-dione (PubChem CID 90904448) has the molecular formula C6H10O5S and a molecular weight of 194.21 g/mol. Its IUPAC name is (2S,5S)-1,2,5-trihydroxy-6-sulfanylhexane-3,4-dione.
| Compound Name | (2S,5S)-1,2,5-trihydroxy-6-sulfanylhexane-3,4-dione |
|---|---|
| PubChem CID | 90904448 |
| Molecular Formula | C6H10O5S |
| Molecular Weight | 194.21 g/mol |
| Exact Mass | 194.02 |
| IUPAC Name | (2S,5S)-1,2,5-trihydroxy-6-sulfanylhexane-3,4-dione |
| SMILES | O=C(C(=O)[C@@H](O)CO)[C@H](O)CS |
| InChI | InChI=1S/C6H10O5S/c7-1-3(8)5(10)6(11)4(9)2-12/h3-4,7-9,12H,1-2H2/t3-,4+/m0/s1 |
| InChIKey | QLGFXWVORGZLCI-IUYQGCFVSA-N |
| XLogP | -2.23 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.21 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|