C23H26F4N4O — CID 90905496
3-[[4-[3-(diethylamino)propylamino]-3-(trifluoromethyl)phenyl]iminomethyl]-4-fluoro-1,3-dihydroindol-2-one (PubChem CID 90905496) has the molecular formula C23H26F4N4O and a molecular weight of 450.48 g/mol. Its IUPAC name is 3-[[4-[3-(diethylamino)propylamino]-3-(trifluoromethyl)phenyl]iminomethyl]-4-fluoro-1,3-dihydroindol-2-one.
| Compound Name | 3-[[4-[3-(diethylamino)propylamino]-3-(trifluoromethyl)phenyl]iminomethyl]-4-fluoro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 90905496 |
| Molecular Formula | C23H26F4N4O |
| Molecular Weight | 450.48 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | 3-[[4-[3-(diethylamino)propylamino]-3-(trifluoromethyl)phenyl]iminomethyl]-4-fluoro-1,3-dihydroindol-2-one |
| SMILES | CCN(CC)CCCNc1ccc(/N=C/C2C(=O)Nc3cccc(F)c32)cc1C(F)(F)F |
| InChI | InChI=1S/C23H26F4N4O/c1-3-31(4-2)12-6-11-28-19-10-9-15(13-17(19)23(25,26)27)29-14-16-21-18(24)7-5-8-20(21)30-22(16)32/h5,7-10,13-14,16,28H,3-4,6,11-12H2,1-2H3,(H,30,32)/b29-14+ |
| InChIKey | NZDRMEFYWFHWPP-IPPBACCNSA-N |
| XLogP | 5.43 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.48 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|