C16H12F3NO4 — CID 90905652
5-(hydroxymethyl)-2-[3-(trifluoromethyl)phenyl]-4,7-dihydro-4,7-epoxyisoindole-1,3-diol (PubChem CID 90905652) has the molecular formula C16H12F3NO4 and a molecular weight of 339.27 g/mol. Its IUPAC name is 5-(hydroxymethyl)-2-[3-(trifluoromethyl)phenyl]-4,7-dihydro-4,7-epoxyisoindole-1,3-diol.
| Compound Name | 5-(hydroxymethyl)-2-[3-(trifluoromethyl)phenyl]-4,7-dihydro-4,7-epoxyisoindole-1,3-diol |
|---|---|
| PubChem CID | 90905652 |
| Molecular Formula | C16H12F3NO4 |
| Molecular Weight | 339.27 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 5-(hydroxymethyl)-2-[3-(trifluoromethyl)phenyl]-4,7-dihydro-4,7-epoxyisoindole-1,3-diol |
| SMILES | OCC1=CC2OC1c1c2c(O)n(-c2cccc(C(F)(F)F)c2)c1O |
| InChI | InChI=1S/C16H12F3NO4/c17-16(18,19)8-2-1-3-9(5-8)20-14(22)11-10-4-7(6-21)13(24-10)12(11)15(20)23/h1-5,10,13,21-23H,6H2 |
| InChIKey | PGRNQYUGSWZBIT-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.27 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|