About 6-bromo-2-[1-(1,3-dioxol-4-yl)-2-phenylethyl]-1-oxo-4-phenylisoquinoline-3-carbaldehyde
6-bromo-2-[1-(1,3-dioxol-4-yl)-2-phenylethyl]-1-oxo-4-phenylisoquinoline-3-carbaldehyde (PubChem CID 90906552) has the molecular formula C27H20BrNO4
and a molecular weight of 502.36 g/mol. Its IUPAC name is 6-bromo-2-[1-(1,3-dioxol-4-yl)-2-phenylethyl]-1-oxo-4-phenylisoquinoline-3-carbaldehyde.
Molecular Properties
| Compound Name | 6-bromo-2-[1-(1,3-dioxol-4-yl)-2-phenylethyl]-1-oxo-4-phenylisoquinoline-3-carbaldehyde |
| PubChem CID | 90906552 |
| Molecular Formula | C27H20BrNO4 |
| Molecular Weight | 502.36 g/mol |
| Exact Mass | 501.06 |
| IUPAC Name | 6-bromo-2-[1-(1,3-dioxol-4-yl)-2-phenylethyl]-1-oxo-4-phenylisoquinoline-3-carbaldehyde |
| SMILES | O=Cc1c(-c2ccccc2)c2cc(Br)ccc2c(=O)n1C(Cc1ccccc1)C1=COCO1 |
| InChI | InChI=1S/C27H20BrNO4/c28-20-11-12-21-22(14-20)26(19-9-5-2-6-10-19)24(15-30)29(27(21)31)23(25-16-32-17-33-25)13-18-7-3-1-4-8-18/h1-12,14-16,23H,13,17H2 |
| InChIKey | KLOQGZNOFANHDC-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 502.36 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-2-[1-(1,3-dioxol-4-yl)-2-phenylethyl]-1-oxo-4-phenylisoquinoline-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2-[1-(1,3-dioxol-4-yl)-2-phenylethyl]-1-oxo-4-phenylisoquinoline-3-carbaldehyde?
The IUPAC name of 6-bromo-2-[1-(1,3-dioxol-4-yl)-2-phenylethyl]-1-oxo-4-phenylisoquinoline-3-carbaldehyde (CID 90906552) is 6-bromo-2-[1-(1,3-dioxol-4-yl)-2-phenylethyl]-1-oxo-4-phenylisoquinoline-3-carbaldehyde.
What is the SMILES notation for 6-bromo-2-[1-(1,3-dioxol-4-yl)-2-phenylethyl]-1-oxo-4-phenylisoquinoline-3-carbaldehyde?
The canonical SMILES for 6-bromo-2-[1-(1,3-dioxol-4-yl)-2-phenylethyl]-1-oxo-4-phenylisoquinoline-3-carbaldehyde is O=Cc1c(-c2ccccc2)c2cc(Br)ccc2c(=O)n1C(Cc1ccccc1)C1=COCO1.
What is the InChIKey of 6-bromo-2-[1-(1,3-dioxol-4-yl)-2-phenylethyl]-1-oxo-4-phenylisoquinoline-3-carbaldehyde?
The InChIKey is KLOQGZNOFANHDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H20BrNO4/c28-20-11-12-21-22(14-20)26(19-9-5-2-6-10-19)24(15-30)29(27(21)31)23(25-16-32-17-33-25)13-18-7-3-1-4-8-18/h1-12,14-16,23H,13,17H2.
What are the key properties of 6-bromo-2-[1-(1,3-dioxol-4-yl)-2-phenylethyl]-1-oxo-4-phenylisoquinoline-3-carbaldehyde?
6-bromo-2-[1-(1,3-dioxol-4-yl)-2-phenylethyl]-1-oxo-4-phenylisoquinoline-3-carbaldehyde has a molecular weight of 502.36 g/mol, XLogP of 5.87, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2-[1-(1,3-dioxol-4-yl)-2-phenylethyl]-1-oxo-4-phenylisoquinoline-3-carbaldehyde is sourced from PubChem (CID 90906552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).