C25H30N2O3S2 — CID 90906564
2-[4-hydroxy-5-[3-(4,4,6,10,10-pentamethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)propa-1,2-dienyl]-2-sulfanylidene-1,3-thiazol-3-yl]acetic acid (PubChem CID 90906564) has the molecular formula C25H30N2O3S2 and a molecular weight of 470.66 g/mol. Its IUPAC name is 2-[4-hydroxy-5-[3-(4,4,6,10,10-pentamethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)propa-1,2-dienyl]-2-sulfanylidene-1,3-thiazol-3-yl]acetic acid.
| Compound Name | 2-[4-hydroxy-5-[3-(4,4,6,10,10-pentamethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)propa-1,2-dienyl]-2-sulfanylidene-1,3-thiazol-3-yl]acetic acid |
|---|---|
| PubChem CID | 90906564 |
| Molecular Formula | C25H30N2O3S2 |
| Molecular Weight | 470.66 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | 2-[4-hydroxy-5-[3-(4,4,6,10,10-pentamethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)propa-1,2-dienyl]-2-sulfanylidene-1,3-thiazol-3-yl]acetic acid |
| SMILES | Cc1c(C=C=Cc2sc(=S)n(CC(=O)O)c2O)cc2c3c1C(C)(C)CCN3CCC2(C)C |
| InChI | InChI=1S/C25H30N2O3S2/c1-15-16(7-6-8-18-22(30)27(14-19(28)29)23(31)32-18)13-17-21-20(15)25(4,5)10-12-26(21)11-9-24(17,2)3/h7-8,13,30H,9-12,14H2,1-5H3,(H,28,29) |
| InChIKey | BEQLXWFFUQDEIA-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 65.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.66 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|