C24H22F3N7O2 — CID 90906836
benzenecarboximidoyl 3-amino-6-[4-[3-(trifluoromethyl)piperazine-1-carbonyl]phenyl]pyrazine-2-carboximidate (PubChem CID 90906836) has the molecular formula C24H22F3N7O2 and a molecular weight of 497.48 g/mol. Its IUPAC name is benzenecarboximidoyl 3-amino-6-[4-[3-(trifluoromethyl)piperazine-1-carbonyl]phenyl]pyrazine-2-carboximidate.
| Compound Name | benzenecarboximidoyl 3-amino-6-[4-[3-(trifluoromethyl)piperazine-1-carbonyl]phenyl]pyrazine-2-carboximidate |
|---|---|
| PubChem CID | 90906836 |
| Molecular Formula | C24H22F3N7O2 |
| Molecular Weight | 497.48 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | benzenecarboximidoyl 3-amino-6-[4-[3-(trifluoromethyl)piperazine-1-carbonyl]phenyl]pyrazine-2-carboximidate |
| SMILES | [H]/N=C(\O/C(=N/[H])c1ccccc1)c1nc(-c2ccc(C(=O)N3CCNC(C(F)(F)F)C3)cc2)cnc1N |
| InChI | InChI=1S/C24H22F3N7O2/c25-24(26,27)18-13-34(11-10-31-18)23(35)16-8-6-14(7-9-16)17-12-32-20(28)19(33-17)22(30)36-21(29)15-4-2-1-3-5-15/h1-9,12,18,29-31H,10-11,13H2,(H2,28,32)/b29-21+,30-22- |
| InChIKey | IETXJZMSWYYKNP-CMQILWEHSA-N |
| XLogP | 3.07 |
| TPSA | 141.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.48 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|