About 3-[[4-[2-phenyl-2-(1,3-thiazol-2-yl)ethyl]piperidin-1-yl]methyl]-1H-pyridin-2-one
3-[[4-[2-phenyl-2-(1,3-thiazol-2-yl)ethyl]piperidin-1-yl]methyl]-1H-pyridin-2-one (PubChem CID 90907176) has the molecular formula C22H25N3OS
and a molecular weight of 379.53 g/mol. Its IUPAC name is 3-[[4-[2-phenyl-2-(1,3-thiazol-2-yl)ethyl]piperidin-1-yl]methyl]-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 3-[[4-[2-phenyl-2-(1,3-thiazol-2-yl)ethyl]piperidin-1-yl]methyl]-1H-pyridin-2-one |
| PubChem CID | 90907176 |
| Molecular Formula | C22H25N3OS |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 3-[[4-[2-phenyl-2-(1,3-thiazol-2-yl)ethyl]piperidin-1-yl]methyl]-1H-pyridin-2-one |
| SMILES | O=c1[nH]cccc1CN1CCC(CC(c2ccccc2)c2nccs2)CC1 |
| InChI | InChI=1S/C22H25N3OS/c26-21-19(7-4-10-23-21)16-25-12-8-17(9-13-25)15-20(22-24-11-14-27-22)18-5-2-1-3-6-18/h1-7,10-11,14,17,20H,8-9,12-13,15-16H2,(H,23,26) |
| InChIKey | PKDQKSXGQIKVNN-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[[4-[2-phenyl-2-(1,3-thiazol-2-yl)ethyl]piperidin-1-yl]methyl]-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-[2-phenyl-2-(1,3-thiazol-2-yl)ethyl]piperidin-1-yl]methyl]-1H-pyridin-2-one?
The IUPAC name of 3-[[4-[2-phenyl-2-(1,3-thiazol-2-yl)ethyl]piperidin-1-yl]methyl]-1H-pyridin-2-one (CID 90907176) is 3-[[4-[2-phenyl-2-(1,3-thiazol-2-yl)ethyl]piperidin-1-yl]methyl]-1H-pyridin-2-one.
What is the SMILES notation for 3-[[4-[2-phenyl-2-(1,3-thiazol-2-yl)ethyl]piperidin-1-yl]methyl]-1H-pyridin-2-one?
The canonical SMILES for 3-[[4-[2-phenyl-2-(1,3-thiazol-2-yl)ethyl]piperidin-1-yl]methyl]-1H-pyridin-2-one is O=c1[nH]cccc1CN1CCC(CC(c2ccccc2)c2nccs2)CC1.
What is the InChIKey of 3-[[4-[2-phenyl-2-(1,3-thiazol-2-yl)ethyl]piperidin-1-yl]methyl]-1H-pyridin-2-one?
The InChIKey is PKDQKSXGQIKVNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25N3OS/c26-21-19(7-4-10-23-21)16-25-12-8-17(9-13-25)15-20(22-24-11-14-27-22)18-5-2-1-3-6-18/h1-7,10-11,14,17,20H,8-9,12-13,15-16H2,(H,23,26).
What are the key properties of 3-[[4-[2-phenyl-2-(1,3-thiazol-2-yl)ethyl]piperidin-1-yl]methyl]-1H-pyridin-2-one?
3-[[4-[2-phenyl-2-(1,3-thiazol-2-yl)ethyl]piperidin-1-yl]methyl]-1H-pyridin-2-one has a molecular weight of 379.53 g/mol, XLogP of 4.27, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-[2-phenyl-2-(1,3-thiazol-2-yl)ethyl]piperidin-1-yl]methyl]-1H-pyridin-2-one is sourced from PubChem (CID 90907176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).