C24H28N6O — CID 90907408
8-hepta-1,3,5-trien-2-yl-2-[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]-8-methyl-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 90907408) has the molecular formula C24H28N6O and a molecular weight of 416.53 g/mol. Its IUPAC name is 8-hepta-1,3,5-trien-2-yl-2-[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]-8-methyl-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 8-hepta-1,3,5-trien-2-yl-2-[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]-8-methyl-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 90907408 |
| Molecular Formula | C24H28N6O |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | 8-hepta-1,3,5-trien-2-yl-2-[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]-8-methyl-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | C=C(C=CC=CC)C1(C)CCCn2nc(-c3ccc(-n4cnc(C)c4)c(OC)n3)nc21 |
| InChI | InChI=1S/C24H28N6O/c1-6-7-8-10-17(2)24(4)13-9-14-30-23(24)27-21(28-30)19-11-12-20(22(26-19)31-5)29-15-18(3)25-16-29/h6-8,10-12,15-16H,2,9,13-14H2,1,3-5H3 |
| InChIKey | ZBOZMQDNGUCJTE-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 70.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|